C22H32N4O3S — CID 139910173
4-[[2-hydroxy-3-[[4-(2-methylbutan-2-yl)phenyl]sulfonylmethylamino]propyl]amino]benzenecarboximidamide (PubChem CID 139910173) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 4-[[2-hydroxy-3-[[4-(2-methylbutan-2-yl)phenyl]sulfonylmethylamino]propyl]amino]benzenecarboximidamide.
| Compound Name | 4-[[2-hydroxy-3-[[4-(2-methylbutan-2-yl)phenyl]sulfonylmethylamino]propyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 139910173 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 4-[[2-hydroxy-3-[[4-(2-methylbutan-2-yl)phenyl]sulfonylmethylamino]propyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCC(O)CNCS(=O)(=O)c2ccc(C(C)(C)CC)cc2)cc1 |
| InChI | InChI=1S/C22H32N4O3S/c1-4-22(2,3)17-7-11-20(12-8-17)30(28,29)15-25-13-19(27)14-26-18-9-5-16(6-10-18)21(23)24/h5-12,19,25-27H,4,13-15H2,1-3H3,(H3,23,24) |
| InChIKey | GRZORGHVWMNESS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 128.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|