C23H29N5O2 — CID 142215652
N-[6-[(4-carbamimidoylbenzoyl)amino]hexyl]-4-ethanimidoylbenzamide (PubChem CID 142215652) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[6-[(4-carbamimidoylbenzoyl)amino]hexyl]-4-ethanimidoylbenzamide.
| Compound Name | N-[6-[(4-carbamimidoylbenzoyl)amino]hexyl]-4-ethanimidoylbenzamide |
|---|---|
| PubChem CID | 142215652 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-[6-[(4-carbamimidoylbenzoyl)amino]hexyl]-4-ethanimidoylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCCCCCCNC(=O)c2ccc(/C(C)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C23H29N5O2/c1-16(24)17-6-10-19(11-7-17)22(29)27-14-4-2-3-5-15-28-23(30)20-12-8-18(9-13-20)21(25)26/h6-13,24H,2-5,14-15H2,1H3,(H3,25,26)(H,27,29)(H,28,30)/b24-16+ |
| InChIKey | IUZBPXNKGBLOER-LFVJCYFKSA-N |
| XLogP | 3.08 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|