C21H29N5O4S2 — CID 142215650
4-[6-[(4-ethanimidoylphenyl)sulfonylamino]hexylsulfamoyl]benzenecarboximidamide (PubChem CID 142215650) has the molecular formula C21H29N5O4S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is 4-[6-[(4-ethanimidoylphenyl)sulfonylamino]hexylsulfamoyl]benzenecarboximidamide.
| Compound Name | 4-[6-[(4-ethanimidoylphenyl)sulfonylamino]hexylsulfamoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142215650 |
| Molecular Formula | C21H29N5O4S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-[6-[(4-ethanimidoylphenyl)sulfonylamino]hexylsulfamoyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(S(=O)(=O)NCCCCCCNS(=O)(=O)c2ccc(/C(C)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C21H29N5O4S2/c1-16(22)17-6-10-19(11-7-17)31(27,28)25-14-4-2-3-5-15-26-32(29,30)20-12-8-18(9-13-20)21(23)24/h6-13,22,25-26H,2-5,14-15H2,1H3,(H3,23,24)/b22-16+ |
| InChIKey | JCCMTWYXJNFZIN-CJLVFECKSA-N |
| XLogP | 2.18 |
| TPSA | 166.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|