C12H18N2O4S — CID 107319438
4-(5-hydroxypentylsulfamoyl)benzamide (PubChem CID 107319438) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-(5-hydroxypentylsulfamoyl)benzamide.
| Compound Name | 4-(5-hydroxypentylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 107319438 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-(5-hydroxypentylsulfamoyl)benzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)NCCCCCO)cc1 |
| InChI | InChI=1S/C12H18N2O4S/c13-12(16)10-4-6-11(7-5-10)19(17,18)14-8-2-1-3-9-15/h4-7,14-15H,1-3,8-9H2,(H2,13,16) |
| InChIKey | AUNCIUVUTCGXDM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|