C21H32Cl2N6O4S2 — CID 162333556
4-[7-[(4-carbamimidoylphenyl)sulfonylamino]heptylsulfamoyl]benzenecarboximidamide;dihydrochloride (PubChem CID 162333556) has the molecular formula C21H32Cl2N6O4S2 and a molecular weight of 567.57 g/mol. Its IUPAC name is 4-[7-[(4-carbamimidoylphenyl)sulfonylamino]heptylsulfamoyl]benzenecarboximidamide;dihydrochloride.
| Compound Name | 4-[7-[(4-carbamimidoylphenyl)sulfonylamino]heptylsulfamoyl]benzenecarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 162333556 |
| Molecular Formula | C21H32Cl2N6O4S2 |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 4-[7-[(4-carbamimidoylphenyl)sulfonylamino]heptylsulfamoyl]benzenecarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(S(=O)(=O)NCCCCCCCNS(=O)(=O)c2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C21H30N6O4S2.2ClH/c22-20(23)16-6-10-18(11-7-16)32(28,29)26-14-4-2-1-3-5-15-27-33(30,31)19-12-8-17(9-13-19)21(24)25;;/h6-13,26-27H,1-5,14-15H2,(H3,22,23)(H3,24,25);2*1H |
| InChIKey | POSNESFUXRXGNX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 192.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|