C33H38N6O6S2 — CID 22002072
4-[[3-[5-[3-[[(4-carbamimidoylphenyl)sulfonylamino]methyl]phenoxy]pentoxy]phenyl]methylsulfamoyl]benzenecarboximidamide (PubChem CID 22002072) has the molecular formula C33H38N6O6S2 and a molecular weight of 678.84 g/mol. Its IUPAC name is 4-[[3-[5-[3-[[(4-carbamimidoylphenyl)sulfonylamino]methyl]phenoxy]pentoxy]phenyl]methylsulfamoyl]benzenecarboximidamide.
| Compound Name | 4-[[3-[5-[3-[[(4-carbamimidoylphenyl)sulfonylamino]methyl]phenoxy]pentoxy]phenyl]methylsulfamoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 22002072 |
| Molecular Formula | C33H38N6O6S2 |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | 4-[[3-[5-[3-[[(4-carbamimidoylphenyl)sulfonylamino]methyl]phenoxy]pentoxy]phenyl]methylsulfamoyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(S(=O)(=O)NCc2cccc(OCCCCCOc3cccc(CNS(=O)(=O)c4ccc(/C(N)=N/[H])cc4)c3)c2)cc1 |
| InChI | InChI=1S/C33H38N6O6S2/c34-32(35)26-10-14-30(15-11-26)46(40,41)38-22-24-6-4-8-28(20-24)44-18-2-1-3-19-45-29-9-5-7-25(21-29)23-39-47(42,43)31-16-12-27(13-17-31)33(36)37/h4-17,20-21,38-39H,1-3,18-19,22-23H2,(H3,34,35)(H3,36,37) |
| InChIKey | NMEKPRQGBWIMGR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 210.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|