C15H18ClN3O3S — CID 71456775
3-[(4-methoxyphenyl)methylsulfamoyl]benzenecarboximidamide;hydrochloride (PubChem CID 71456775) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methylsulfamoyl]benzenecarboximidamide;hydrochloride.
| Compound Name | 3-[(4-methoxyphenyl)methylsulfamoyl]benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 71456775 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3-[(4-methoxyphenyl)methylsulfamoyl]benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc(S(=O)(=O)NCc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C15H17N3O3S.ClH/c1-21-13-7-5-11(6-8-13)10-18-22(19,20)14-4-2-3-12(9-14)15(16)17;/h2-9,18H,10H2,1H3,(H3,16,17);1H |
| InChIKey | LJLLNPDSBTUNBM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|