C18H18N2O5S2 — CID 31109957
3-N-[(6-methoxynaphthalen-2-yl)methyl]benzene-1,3-disulfonamide (PubChem CID 31109957) has the molecular formula C18H18N2O5S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-N-[(6-methoxynaphthalen-2-yl)methyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[(6-methoxynaphthalen-2-yl)methyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 31109957 |
| Molecular Formula | C18H18N2O5S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3-N-[(6-methoxynaphthalen-2-yl)methyl]benzene-1,3-disulfonamide |
| SMILES | COc1ccc2cc(CNS(=O)(=O)c3cccc(S(N)(=O)=O)c3)ccc2c1 |
| InChI | InChI=1S/C18H18N2O5S2/c1-25-16-8-7-14-9-13(5-6-15(14)10-16)12-20-27(23,24)18-4-2-3-17(11-18)26(19,21)22/h2-11,20H,12H2,1H3,(H2,19,21,22) |
| InChIKey | FIMGEUSABTXEIF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |