C17H20N4O5S — CID 71449633
2-[(4-carbamimidoylphenyl)sulfonylamino]-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 71449633) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-[(4-carbamimidoylphenyl)sulfonylamino]-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(4-carbamimidoylphenyl)sulfonylamino]-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 71449633 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[(4-carbamimidoylphenyl)sulfonylamino]-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | [H]/N=C(\N)c1ccc(S(=O)(=O)NCC(=O)Nc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C17H20N4O5S/c1-25-14-8-5-12(9-15(14)26-2)21-16(22)10-20-27(23,24)13-6-3-11(4-7-13)17(18)19/h3-9,20H,10H2,1-2H3,(H3,18,19)(H,21,22) |
| InChIKey | GAZYIRHLDBYLCW-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|