C18H22N2O6S — CID 112999332
N-(3,4-dimethoxyphenyl)-2-[(4-ethoxyphenyl)sulfonylamino]acetamide (PubChem CID 112999332) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[(4-ethoxyphenyl)sulfonylamino]acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[(4-ethoxyphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 112999332 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[(4-ethoxyphenyl)sulfonylamino]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCC(=O)Nc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H22N2O6S/c1-4-26-14-6-8-15(9-7-14)27(22,23)19-12-18(21)20-13-5-10-16(24-2)17(11-13)25-3/h5-11,19H,4,12H2,1-3H3,(H,20,21) |
| InChIKey | NCGZVMFUMYGRGJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |