C21H25N5O3 — CID 142215662
N-[2-[2-[(4-carbamimidoylbenzoyl)amino]ethoxy]ethyl]-4-ethanimidoylbenzamide (PubChem CID 142215662) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[2-[2-[(4-carbamimidoylbenzoyl)amino]ethoxy]ethyl]-4-ethanimidoylbenzamide.
| Compound Name | N-[2-[2-[(4-carbamimidoylbenzoyl)amino]ethoxy]ethyl]-4-ethanimidoylbenzamide |
|---|---|
| PubChem CID | 142215662 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[2-[2-[(4-carbamimidoylbenzoyl)amino]ethoxy]ethyl]-4-ethanimidoylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCCOCCNC(=O)c2ccc(/C(C)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C21H25N5O3/c1-14(22)15-2-6-17(7-3-15)20(27)25-10-12-29-13-11-26-21(28)18-8-4-16(5-9-18)19(23)24/h2-9,22H,10-13H2,1H3,(H3,23,24)(H,25,27)(H,26,28)/b22-14+ |
| InChIKey | YXDYUIKLOXXWBU-HYARGMPZSA-N |
| XLogP | 1.53 |
| TPSA | 141.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|