C7H10N4O2S — CID 114959670
4-(sulfamoylamino)benzenecarboximidamide (PubChem CID 114959670) has the molecular formula C7H10N4O2S and a molecular weight of 214.25 g/mol. Its IUPAC name is 4-(sulfamoylamino)benzenecarboximidamide.
| Compound Name | 4-(sulfamoylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 114959670 |
| Molecular Formula | C7H10N4O2S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 4-(sulfamoylamino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C7H10N4O2S/c8-7(9)5-1-3-6(4-2-5)11-14(10,12)13/h1-4,11H,(H3,8,9)(H2,10,12,13) |
| InChIKey | YCDVTJSUUHIVTM-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|