C11H16ClN3O2S2 — CID 114808497
3-(tert-butylsulfamoylamino)-4-chlorobenzenecarbothioamide (PubChem CID 114808497) has the molecular formula C11H16ClN3O2S2 and a molecular weight of 321.86 g/mol. Its IUPAC name is 3-(tert-butylsulfamoylamino)-4-chlorobenzenecarbothioamide.
| Compound Name | 3-(tert-butylsulfamoylamino)-4-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 114808497 |
| Molecular Formula | C11H16ClN3O2S2 |
| Molecular Weight | 321.86 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 3-(tert-butylsulfamoylamino)-4-chlorobenzenecarbothioamide |
| SMILES | CC(C)(C)NS(=O)(=O)Nc1cc(C(N)=S)ccc1Cl |
| InChI | InChI=1S/C11H16ClN3O2S2/c1-11(2,3)15-19(16,17)14-9-6-7(10(13)18)4-5-8(9)12/h4-6,14-15H,1-3H3,(H2,13,18) |
| InChIKey | HJAZIOIDKDIAML-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.86 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|