C10H16ClN3O2S — CID 114804191
2-N-(tert-butylsulfamoyl)-4-chlorobenzene-1,2-diamine (PubChem CID 114804191) has the molecular formula C10H16ClN3O2S and a molecular weight of 277.78 g/mol. Its IUPAC name is 2-N-(tert-butylsulfamoyl)-4-chlorobenzene-1,2-diamine.
| Compound Name | 2-N-(tert-butylsulfamoyl)-4-chlorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 114804191 |
| Molecular Formula | C10H16ClN3O2S |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-N-(tert-butylsulfamoyl)-4-chlorobenzene-1,2-diamine |
| SMILES | CC(C)(C)NS(=O)(=O)Nc1cc(Cl)ccc1N |
| InChI | InChI=1S/C10H16ClN3O2S/c1-10(2,3)14-17(15,16)13-9-6-7(11)4-5-8(9)12/h4-6,13-14H,12H2,1-3H3 |
| InChIKey | LPSITCRXQXKNDY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|