C11H18FN3O2S — CID 114804109
4-(aminomethyl)-N-(tert-butylsulfamoyl)-2-fluoroaniline (PubChem CID 114804109) has the molecular formula C11H18FN3O2S and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(tert-butylsulfamoyl)-2-fluoroaniline.
| Compound Name | 4-(aminomethyl)-N-(tert-butylsulfamoyl)-2-fluoroaniline |
|---|---|
| PubChem CID | 114804109 |
| Molecular Formula | C11H18FN3O2S |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 4-(aminomethyl)-N-(tert-butylsulfamoyl)-2-fluoroaniline |
| SMILES | CC(C)(C)NS(=O)(=O)Nc1ccc(CN)cc1F |
| InChI | InChI=1S/C11H18FN3O2S/c1-11(2,3)15-18(16,17)14-10-5-4-8(7-13)6-9(10)12/h4-6,14-15H,7,13H2,1-3H3 |
| InChIKey | XYQQYJLZYDKTMW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |