C12H21N3O2S — CID 114804269
3-N-(tert-butylsulfamoyl)-2,4-dimethylbenzene-1,3-diamine (PubChem CID 114804269) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 3-N-(tert-butylsulfamoyl)-2,4-dimethylbenzene-1,3-diamine.
| Compound Name | 3-N-(tert-butylsulfamoyl)-2,4-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 114804269 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-N-(tert-butylsulfamoyl)-2,4-dimethylbenzene-1,3-diamine |
| SMILES | Cc1ccc(N)c(C)c1NS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C12H21N3O2S/c1-8-6-7-10(13)9(2)11(8)14-18(16,17)15-12(3,4)5/h6-7,14-15H,13H2,1-5H3 |
| InChIKey | KQYJLGRURSFDHU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|