C12H19N3O3S — CID 28783497
N-(3-amino-2,6-dimethylphenyl)morpholine-4-sulfonamide (PubChem CID 28783497) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is N-(3-amino-2,6-dimethylphenyl)morpholine-4-sulfonamide.
| Compound Name | N-(3-amino-2,6-dimethylphenyl)morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 28783497 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-(3-amino-2,6-dimethylphenyl)morpholine-4-sulfonamide |
| SMILES | Cc1ccc(N)c(C)c1NS(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H19N3O3S/c1-9-3-4-11(13)10(2)12(9)14-19(16,17)15-5-7-18-8-6-15/h3-4,14H,5-8,13H2,1-2H3 |
| InChIKey | JACUGUCQODZGAZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|