C12H12ClN3O2S — CID 107624515
6-amino-N-(2-chloro-5-methylphenyl)pyridine-3-sulfonamide (PubChem CID 107624515) has the molecular formula C12H12ClN3O2S and a molecular weight of 297.77 g/mol. Its IUPAC name is 6-amino-N-(2-chloro-5-methylphenyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-N-(2-chloro-5-methylphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107624515 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 6-amino-N-(2-chloro-5-methylphenyl)pyridine-3-sulfonamide |
| SMILES | Cc1ccc(Cl)c(NS(=O)(=O)c2ccc(N)nc2)c1 |
| InChI | InChI=1S/C12H12ClN3O2S/c1-8-2-4-10(13)11(6-8)16-19(17,18)9-3-5-12(14)15-7-9/h2-7,16H,1H3,(H2,14,15) |
| InChIKey | ZENDIEHOOCEWJP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |