C12H11BrClN3O2S — CID 82767078
6-amino-N-(2-bromo-5-methylphenyl)-5-chloropyridine-3-sulfonamide (PubChem CID 82767078) has the molecular formula C12H11BrClN3O2S and a molecular weight of 376.66 g/mol. Its IUPAC name is 6-amino-N-(2-bromo-5-methylphenyl)-5-chloropyridine-3-sulfonamide.
| Compound Name | 6-amino-N-(2-bromo-5-methylphenyl)-5-chloropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 82767078 |
| Molecular Formula | C12H11BrClN3O2S |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | 6-amino-N-(2-bromo-5-methylphenyl)-5-chloropyridine-3-sulfonamide |
| SMILES | Cc1ccc(Br)c(NS(=O)(=O)c2cnc(N)c(Cl)c2)c1 |
| InChI | InChI=1S/C12H11BrClN3O2S/c1-7-2-3-9(13)11(4-7)17-20(18,19)8-5-10(14)12(15)16-6-8/h2-6,17H,1H3,(H2,15,16) |
| InChIKey | DUBTTYNUDMCHKI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |