C11H11FN4O2S — CID 62143731
2-amino-N-(2-fluoro-5-methylphenyl)pyrimidine-5-sulfonamide (PubChem CID 62143731) has the molecular formula C11H11FN4O2S and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-amino-N-(2-fluoro-5-methylphenyl)pyrimidine-5-sulfonamide.
| Compound Name | 2-amino-N-(2-fluoro-5-methylphenyl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62143731 |
| Molecular Formula | C11H11FN4O2S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-amino-N-(2-fluoro-5-methylphenyl)pyrimidine-5-sulfonamide |
| SMILES | Cc1ccc(F)c(NS(=O)(=O)c2cnc(N)nc2)c1 |
| InChI | InChI=1S/C11H11FN4O2S/c1-7-2-3-9(12)10(4-7)16-19(17,18)8-5-14-11(13)15-6-8/h2-6,16H,1H3,(H2,13,14,15) |
| InChIKey | VARQHJMUPNORPO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |