C8H9Cl2N3O6S2 — CID 114466073
methyl N-[(2,6-dichloro-4-sulfamoylphenyl)sulfamoyl]carbamate (PubChem CID 114466073) has the molecular formula C8H9Cl2N3O6S2 and a molecular weight of 378.22 g/mol. Its IUPAC name is methyl N-[(2,6-dichloro-4-sulfamoylphenyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(2,6-dichloro-4-sulfamoylphenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114466073 |
| Molecular Formula | C8H9Cl2N3O6S2 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 376.93 |
| IUPAC Name | methyl N-[(2,6-dichloro-4-sulfamoylphenyl)sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)Nc1c(Cl)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C8H9Cl2N3O6S2/c1-19-8(14)13-21(17,18)12-7-5(9)2-4(3-6(7)10)20(11,15)16/h2-3,12H,1H3,(H,13,14)(H2,11,15,16) |
| InChIKey | AWQMSYYXWYRVMQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |