C12H18N2O4S — CID 110193344
methyl N-[(2,6-diethylphenyl)sulfamoyl]carbamate (PubChem CID 110193344) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is methyl N-[(2,6-diethylphenyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(2,6-diethylphenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 110193344 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | methyl N-[(2,6-diethylphenyl)sulfamoyl]carbamate |
| SMILES | CCc1cccc(CC)c1NS(=O)(=O)NC(=O)OC |
| InChI | InChI=1S/C12H18N2O4S/c1-4-9-7-6-8-10(5-2)11(9)13-19(16,17)14-12(15)18-3/h6-8,13H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | WGHQPBYKIXLFRH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |