C9H13N3O6S2 — CID 114465998
methyl N-[(2-methyl-3-sulfamoylphenyl)sulfamoyl]carbamate (PubChem CID 114465998) has the molecular formula C9H13N3O6S2 and a molecular weight of 323.35 g/mol. Its IUPAC name is methyl N-[(2-methyl-3-sulfamoylphenyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(2-methyl-3-sulfamoylphenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114465998 |
| Molecular Formula | C9H13N3O6S2 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | methyl N-[(2-methyl-3-sulfamoylphenyl)sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)Nc1cccc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C9H13N3O6S2/c1-6-7(4-3-5-8(6)19(10,14)15)11-20(16,17)12-9(13)18-2/h3-5,11H,1-2H3,(H,12,13)(H2,10,14,15) |
| InChIKey | FTCKOPNQPINCSL-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |