C8H11N3O6S2 — CID 113343903
methyl N-[(3-sulfamoylphenyl)sulfamoyl]carbamate (PubChem CID 113343903) has the molecular formula C8H11N3O6S2 and a molecular weight of 309.33 g/mol. Its IUPAC name is methyl N-[(3-sulfamoylphenyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(3-sulfamoylphenyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 113343903 |
| Molecular Formula | C8H11N3O6S2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | methyl N-[(3-sulfamoylphenyl)sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C8H11N3O6S2/c1-17-8(12)11-19(15,16)10-6-3-2-4-7(5-6)18(9,13)14/h2-5,10H,1H3,(H,11,12)(H2,9,13,14) |
| InChIKey | OOIFWZUMXBHLBP-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |