C9H14N2O6S3 — CID 63243241
3-(2-methylsulfonylethylsulfonylamino)benzenesulfonamide (PubChem CID 63243241) has the molecular formula C9H14N2O6S3 and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-(2-methylsulfonylethylsulfonylamino)benzenesulfonamide.
| Compound Name | 3-(2-methylsulfonylethylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 63243241 |
| Molecular Formula | C9H14N2O6S3 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 3-(2-methylsulfonylethylsulfonylamino)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H14N2O6S3/c1-18(12,13)5-6-19(14,15)11-8-3-2-4-9(7-8)20(10,16)17/h2-4,7,11H,5-6H2,1H3,(H2,10,16,17) |
| InChIKey | LDLDMQHKDZNFHN-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |