C10H15NO5S2 — CID 64794415
N-(3-hydroxy-4-methylphenyl)-2-methylsulfonylethanesulfonamide (PubChem CID 64794415) has the molecular formula C10H15NO5S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(3-hydroxy-4-methylphenyl)-2-methylsulfonylethanesulfonamide.
| Compound Name | N-(3-hydroxy-4-methylphenyl)-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 64794415 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | N-(3-hydroxy-4-methylphenyl)-2-methylsulfonylethanesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)CCS(C)(=O)=O)cc1O |
| InChI | InChI=1S/C10H15NO5S2/c1-8-3-4-9(7-10(8)12)11-18(15,16)6-5-17(2,13)14/h3-4,7,11-12H,5-6H2,1-2H3 |
| InChIKey | DNSQHQLOWFFJNX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |