C9H10N2O7S — CID 114462428
5-hydroxy-2-(methoxycarbonylsulfamoylamino)benzoic acid (PubChem CID 114462428) has the molecular formula C9H10N2O7S and a molecular weight of 290.25 g/mol. Its IUPAC name is 5-hydroxy-2-(methoxycarbonylsulfamoylamino)benzoic acid.
| Compound Name | 5-hydroxy-2-(methoxycarbonylsulfamoylamino)benzoic acid |
|---|---|
| PubChem CID | 114462428 |
| Molecular Formula | C9H10N2O7S |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 5-hydroxy-2-(methoxycarbonylsulfamoylamino)benzoic acid |
| SMILES | COC(=O)NS(=O)(=O)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C9H10N2O7S/c1-18-9(15)11-19(16,17)10-7-3-2-5(12)4-6(7)8(13)14/h2-4,10,12H,1H3,(H,11,15)(H,13,14) |
| InChIKey | XMOWTVIOTTVJGT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|