C11H11N3O5S — CID 61406079
5-hydroxy-2-[(1-methylpyrazol-4-yl)sulfonylamino]benzoic acid (PubChem CID 61406079) has the molecular formula C11H11N3O5S and a molecular weight of 297.29 g/mol. Its IUPAC name is 5-hydroxy-2-[(1-methylpyrazol-4-yl)sulfonylamino]benzoic acid.
| Compound Name | 5-hydroxy-2-[(1-methylpyrazol-4-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 61406079 |
| Molecular Formula | C11H11N3O5S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-hydroxy-2-[(1-methylpyrazol-4-yl)sulfonylamino]benzoic acid |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccc(O)cc2C(=O)O)cn1 |
| InChI | InChI=1S/C11H11N3O5S/c1-14-6-8(5-12-14)20(18,19)13-10-3-2-7(15)4-9(10)11(16)17/h2-6,13,15H,1H3,(H,16,17) |
| InChIKey | UPDUSJRYYAZWQP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|