C11H13N3O5S2 — CID 81421576
N-(2-hydroxy-5-methylsulfonylphenyl)-1-methylpyrazole-4-sulfonamide (PubChem CID 81421576) has the molecular formula C11H13N3O5S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(2-hydroxy-5-methylsulfonylphenyl)-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-(2-hydroxy-5-methylsulfonylphenyl)-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 81421576 |
| Molecular Formula | C11H13N3O5S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-(2-hydroxy-5-methylsulfonylphenyl)-1-methylpyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2cc(S(C)(=O)=O)ccc2O)cn1 |
| InChI | InChI=1S/C11H13N3O5S2/c1-14-7-9(6-12-14)21(18,19)13-10-5-8(20(2,16)17)3-4-11(10)15/h3-7,13,15H,1-2H3 |
| InChIKey | JKFCGPXFSIDZSY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|