C11H13N3O5S2 — CID 81422171
N-(2-hydroxy-5-methylsulfonylphenyl)-2-methyl-1H-imidazole-5-sulfonamide (PubChem CID 81422171) has the molecular formula C11H13N3O5S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-(2-hydroxy-5-methylsulfonylphenyl)-2-methyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-(2-hydroxy-5-methylsulfonylphenyl)-2-methyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 81422171 |
| Molecular Formula | C11H13N3O5S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-(2-hydroxy-5-methylsulfonylphenyl)-2-methyl-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2cc(S(C)(=O)=O)ccc2O)[nH]1 |
| InChI | InChI=1S/C11H13N3O5S2/c1-7-12-6-11(13-7)21(18,19)14-9-5-8(20(2,16)17)3-4-10(9)15/h3-6,14-15H,1-2H3,(H,12,13) |
| InChIKey | QPOJIXXFUXSTMT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|