C10H10ClN3O3S — CID 64786558
N-(3-chloro-4-hydroxyphenyl)-2-methyl-1H-imidazole-5-sulfonamide (PubChem CID 64786558) has the molecular formula C10H10ClN3O3S and a molecular weight of 287.73 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)-2-methyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)-2-methyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 64786558 |
| Molecular Formula | C10H10ClN3O3S |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)-2-methyl-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2ccc(O)c(Cl)c2)[nH]1 |
| InChI | InChI=1S/C10H10ClN3O3S/c1-6-12-5-10(13-6)18(16,17)14-7-2-3-9(15)8(11)4-7/h2-5,14-15H,1H3,(H,12,13) |
| InChIKey | ZNHRKBSPFBQVLO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|