C11H7Cl3N2O3S — CID 103930794
5,6-dichloro-N-(3-chloro-4-hydroxyphenyl)pyridine-3-sulfonamide (PubChem CID 103930794) has the molecular formula C11H7Cl3N2O3S and a molecular weight of 353.61 g/mol. Its IUPAC name is 5,6-dichloro-N-(3-chloro-4-hydroxyphenyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(3-chloro-4-hydroxyphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103930794 |
| Molecular Formula | C11H7Cl3N2O3S |
| Molecular Weight | 353.61 g/mol |
| Exact Mass | 351.92 |
| IUPAC Name | 5,6-dichloro-N-(3-chloro-4-hydroxyphenyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(O)c(Cl)c1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H7Cl3N2O3S/c12-8-3-6(1-2-10(8)17)16-20(18,19)7-4-9(13)11(14)15-5-7/h1-5,16-17H |
| InChIKey | XFQKVBXNCLPRPY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|