C10H6Cl2FN3O2S — CID 64687580
5,6-dichloro-N-(5-fluoro-2-pyridinyl)pyridine-3-sulfonamide (PubChem CID 64687580) has the molecular formula C10H6Cl2FN3O2S and a molecular weight of 322.15 g/mol. Its IUPAC name is 5,6-dichloro-N-(5-fluoro-2-pyridinyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(5-fluoro-2-pyridinyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64687580 |
| Molecular Formula | C10H6Cl2FN3O2S |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | 5,6-dichloro-N-(5-fluoro-2-pyridinyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)cn1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H6Cl2FN3O2S/c11-8-3-7(5-15-10(8)12)19(17,18)16-9-2-1-6(13)4-14-9/h1-5H,(H,14,16) |
| InChIKey | UPOLZICKJURGSP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|