C11H12ClN3O2S — CID 62997807
N-(5-chloro-2-methylphenyl)-2-methyl-1H-imidazole-5-sulfonamide (PubChem CID 62997807) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-methyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-methyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 62997807 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-methyl-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2cc(Cl)ccc2C)[nH]1 |
| InChI | InChI=1S/C11H12ClN3O2S/c1-7-3-4-9(12)5-10(7)15-18(16,17)11-6-13-8(2)14-11/h3-6,15H,1-2H3,(H,13,14) |
| InChIKey | GYLFNQYWAFQXNH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |