C11H17NO5S2 — CID 81434171
N-(2-hydroxy-5-methylsulfonylphenyl)-2-methylpropane-1-sulfonamide (PubChem CID 81434171) has the molecular formula C11H17NO5S2 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-(2-hydroxy-5-methylsulfonylphenyl)-2-methylpropane-1-sulfonamide.
| Compound Name | N-(2-hydroxy-5-methylsulfonylphenyl)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 81434171 |
| Molecular Formula | C11H17NO5S2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-(2-hydroxy-5-methylsulfonylphenyl)-2-methylpropane-1-sulfonamide |
| SMILES | CC(C)CS(=O)(=O)Nc1cc(S(C)(=O)=O)ccc1O |
| InChI | InChI=1S/C11H17NO5S2/c1-8(2)7-19(16,17)12-10-6-9(18(3,14)15)4-5-11(10)13/h4-6,8,12-13H,7H2,1-3H3 |
| InChIKey | BMMFFBSQTSWRLO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|