C11H14F3NO3S — CID 79041071
N-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-methylpropane-1-sulfonamide (PubChem CID 79041071) has the molecular formula C11H14F3NO3S and a molecular weight of 297.30 g/mol. Its IUPAC name is N-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-methylpropane-1-sulfonamide.
| Compound Name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79041071 |
| Molecular Formula | C11H14F3NO3S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-methylpropane-1-sulfonamide |
| SMILES | CC(C)CS(=O)(=O)Nc1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C11H14F3NO3S/c1-7(2)6-19(17,18)15-9-5-8(11(12,13)14)3-4-10(9)16/h3-5,7,15-16H,6H2,1-2H3 |
| InChIKey | JLGSEAMQFDQYEW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|