C12H14F3NO4S — CID 81198712
N-[2-hydroxy-5-(trifluoromethyl)phenyl]oxane-4-sulfonamide (PubChem CID 81198712) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is N-[2-hydroxy-5-(trifluoromethyl)phenyl]oxane-4-sulfonamide.
| Compound Name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]oxane-4-sulfonamide |
|---|---|
| PubChem CID | 81198712 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]oxane-4-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(C(F)(F)F)ccc1O)C1CCOCC1 |
| InChI | InChI=1S/C12H14F3NO4S/c13-12(14,15)8-1-2-11(17)10(7-8)16-21(18,19)9-3-5-20-6-4-9/h1-2,7,9,16-17H,3-6H2 |
| InChIKey | CBHWXQSPFHFLQL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|