C13H14F3NO3 — CID 96569116
N-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-[(2S)-oxolan-2-yl]acetamide (PubChem CID 96569116) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is N-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-[(2S)-oxolan-2-yl]acetamide.
| Compound Name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-[(2S)-oxolan-2-yl]acetamide |
|---|---|
| PubChem CID | 96569116 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[2-hydroxy-5-(trifluoromethyl)phenyl]-2-[(2S)-oxolan-2-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCCO1)Nc1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C13H14F3NO3/c14-13(15,16)8-3-4-11(18)10(6-8)17-12(19)7-9-2-1-5-20-9/h3-4,6,9,18H,1-2,5,7H2,(H,17,19)/t9-/m0/s1 |
| InChIKey | HCFFKZXGMUZOAX-VIFPVBQESA-N |
| XLogP | 2.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|