C9H8F4N2O3S — CID 61132230
3,3,3-trifluoro-N-(3-fluoro-5-sulfamoylphenyl)propanamide (PubChem CID 61132230) has the molecular formula C9H8F4N2O3S and a molecular weight of 300.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-(3-fluoro-5-sulfamoylphenyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-(3-fluoro-5-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 61132230 |
| Molecular Formula | C9H8F4N2O3S |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 3,3,3-trifluoro-N-(3-fluoro-5-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1cc(F)cc(NC(=O)CC(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F4N2O3S/c10-5-1-6(3-7(2-5)19(14,17)18)15-8(16)4-9(11,12)13/h1-3H,4H2,(H,15,16)(H2,14,17,18) |
| InChIKey | JQAHLFOXFFOXLT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |