C15H14ClFN2O3S2 — CID 55980561
2-[(3-chlorophenyl)methylsulfanyl]-N-(3-fluoro-5-sulfamoylphenyl)acetamide (PubChem CID 55980561) has the molecular formula C15H14ClFN2O3S2 and a molecular weight of 388.87 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylsulfanyl]-N-(3-fluoro-5-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(3-chlorophenyl)methylsulfanyl]-N-(3-fluoro-5-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 55980561 |
| Molecular Formula | C15H14ClFN2O3S2 |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 2-[(3-chlorophenyl)methylsulfanyl]-N-(3-fluoro-5-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1cc(F)cc(NC(=O)CSCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C15H14ClFN2O3S2/c16-11-3-1-2-10(4-11)8-23-9-15(20)19-13-5-12(17)6-14(7-13)24(18,21)22/h1-7H,8-9H2,(H,19,20)(H2,18,21,22) |
| InChIKey | XGHVXAFDMRXUBS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |