C18H19ClN2O5S2 — CID 42981287
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-[(3-chlorophenyl)methylsulfanyl]acetate (PubChem CID 42981287) has the molecular formula C18H19ClN2O5S2 and a molecular weight of 442.95 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-[(3-chlorophenyl)methylsulfanyl]acetate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-[(3-chlorophenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 42981287 |
| Molecular Formula | C18H19ClN2O5S2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-[(3-chlorophenyl)methylsulfanyl]acetate |
| SMILES | CC(OC(=O)CSCc1cccc(Cl)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H19ClN2O5S2/c1-12(18(23)21-15-5-7-16(8-6-15)28(20,24)25)26-17(22)11-27-10-13-3-2-4-14(19)9-13/h2-9,12H,10-11H2,1H3,(H,21,23)(H2,20,24,25) |
| InChIKey | BNRDNCQINRRFLP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |