C17H17FN2O6S — CID 8914750
[(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(3-fluorophenoxy)acetate (PubChem CID 8914750) has the molecular formula C17H17FN2O6S and a molecular weight of 396.40 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(3-fluorophenoxy)acetate.
| Compound Name | [(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(3-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8914750 |
| Molecular Formula | C17H17FN2O6S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [(2R)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(3-fluorophenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1cccc(F)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H17FN2O6S/c1-11(26-16(21)10-25-14-4-2-3-12(18)9-14)17(22)20-13-5-7-15(8-6-13)27(19,23)24/h2-9,11H,10H2,1H3,(H,20,22)(H2,19,23,24)/t11-/m1/s1 |
| InChIKey | DITRLDWPYNCZEH-LLVKDONJSA-N |
| XLogP | 1.42 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |