C18H15FN2O4 — CID 8914655
[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(3-fluorophenoxy)acetate (PubChem CID 8914655) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(3-fluorophenoxy)acetate.
| Compound Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(3-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8914655 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-(3-fluorophenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1cccc(F)c1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H15FN2O4/c1-12(18(23)21-15-6-2-4-13(8-15)10-20)25-17(22)11-24-16-7-3-5-14(19)9-16/h2-9,12H,11H2,1H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | NIYASESNXHADLI-LBPRGKRZSA-N |
| XLogP | 2.65 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |