C15H15ClN4O8S2 — CID 11952431
[4-[2-(5-chloro-2,4-disulfamoylanilino)-2-oxoethyl]phenyl]methyl nitrate (PubChem CID 11952431) has the molecular formula C15H15ClN4O8S2 and a molecular weight of 478.89 g/mol. Its IUPAC name is [4-[2-(5-chloro-2,4-disulfamoylanilino)-2-oxoethyl]phenyl]methyl nitrate.
| Compound Name | [4-[2-(5-chloro-2,4-disulfamoylanilino)-2-oxoethyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 11952431 |
| Molecular Formula | C15H15ClN4O8S2 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | [4-[2-(5-chloro-2,4-disulfamoylanilino)-2-oxoethyl]phenyl]methyl nitrate |
| SMILES | NS(=O)(=O)c1cc(S(N)(=O)=O)c(NC(=O)Cc2ccc(CO[N+](=O)[O-])cc2)cc1Cl |
| InChI | InChI=1S/C15H15ClN4O8S2/c16-11-6-12(14(30(18,26)27)7-13(11)29(17,24)25)19-15(21)5-9-1-3-10(4-2-9)8-28-20(22)23/h1-4,6-7H,5,8H2,(H,19,21)(H2,17,24,25)(H2,18,26,27) |
| InChIKey | BPKFURDLZXXBHO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 201.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|