C16H20Cl2N4O9S2 — CID 10792692
N-(5-chloro-2,4-disulfamoylphenyl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate (PubChem CID 10792692) has the molecular formula C16H20Cl2N4O9S2 and a molecular weight of 547.40 g/mol. Its IUPAC name is N-(5-chloro-2,4-disulfamoylphenyl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate.
| Compound Name | N-(5-chloro-2,4-disulfamoylphenyl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate |
|---|---|
| PubChem CID | 10792692 |
| Molecular Formula | C16H20Cl2N4O9S2 |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 546.00 |
| IUPAC Name | N-(5-chloro-2,4-disulfamoylphenyl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate |
| SMILES | Cc1cc(C)[n+](CC(=O)Nc2cc(Cl)c(S(N)(=O)=O)cc2S(N)(=O)=O)c(C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H19ClN4O5S2.ClHO4/c1-9-4-10(2)21(11(3)5-9)8-16(22)20-13-6-12(17)14(27(18,23)24)7-15(13)28(19,25)26;2-1(3,4)5/h4-7H,8H2,1-3H3,(H4-,18,19,20,22,23,24,25,26);(H,2,3,4,5) |
| InChIKey | NWGDPNJCDJLBDQ-UHFFFAOYSA-N |
| XLogP | -4.27 |
| TPSA | 245.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|