C11H11ClLiNO5S — CID 101303942
lithium 2-chloro-5-methyl-4-(3-oxobutanoylamino)benzenesulfonate (PubChem CID 101303942) has the molecular formula C11H11ClLiNO5S and a molecular weight of 311.67 g/mol. Its IUPAC name is lithium 2-chloro-5-methyl-4-(3-oxobutanoylamino)benzenesulfonate.
| Compound Name | lithium 2-chloro-5-methyl-4-(3-oxobutanoylamino)benzenesulfonate |
|---|---|
| PubChem CID | 101303942 |
| Molecular Formula | C11H11ClLiNO5S |
| Molecular Weight | 311.67 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | lithium 2-chloro-5-methyl-4-(3-oxobutanoylamino)benzenesulfonate |
| SMILES | CC(=O)CC(=O)Nc1cc(Cl)c(S(=O)(=O)[O-])cc1C.[Li+] |
| InChI | InChI=1S/C11H12ClNO5S.Li/c1-6-3-10(19(16,17)18)8(12)5-9(6)13-11(15)4-7(2)14;/h3,5H,4H2,1-2H3,(H,13,15)(H,16,17,18);/q;+1/p-1 |
| InChIKey | IGRHZCVTTXWKRA-UHFFFAOYSA-M |
| XLogP | -1.53 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.67 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|