C17H18Br2N2O4S — CID 154087770
4-benzyl-3-(2,3-dibromopropylamino)-5-sulfamoylbenzoic acid (PubChem CID 154087770) has the molecular formula C17H18Br2N2O4S and a molecular weight of 506.22 g/mol. Its IUPAC name is 4-benzyl-3-(2,3-dibromopropylamino)-5-sulfamoylbenzoic acid.
| Compound Name | 4-benzyl-3-(2,3-dibromopropylamino)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 154087770 |
| Molecular Formula | C17H18Br2N2O4S |
| Molecular Weight | 506.22 g/mol |
| Exact Mass | 503.94 |
| IUPAC Name | 4-benzyl-3-(2,3-dibromopropylamino)-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc(NCC(Br)CBr)c1Cc1ccccc1 |
| InChI | InChI=1S/C17H18Br2N2O4S/c18-9-13(19)10-21-15-7-12(17(22)23)8-16(26(20,24)25)14(15)6-11-4-2-1-3-5-11/h1-5,7-8,13,21H,6,9-10H2,(H,22,23)(H2,20,24,25) |
| InChIKey | ZTSPRCKXNAYWLP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|