C18H23BrN2O2S — CID 57094242
2-benzyl-5-(bromomethyl)-3-(butylamino)benzenesulfonamide (PubChem CID 57094242) has the molecular formula C18H23BrN2O2S and a molecular weight of 411.37 g/mol. Its IUPAC name is 2-benzyl-5-(bromomethyl)-3-(butylamino)benzenesulfonamide.
| Compound Name | 2-benzyl-5-(bromomethyl)-3-(butylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 57094242 |
| Molecular Formula | C18H23BrN2O2S |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-benzyl-5-(bromomethyl)-3-(butylamino)benzenesulfonamide |
| SMILES | CCCCNc1cc(CBr)cc(S(N)(=O)=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C18H23BrN2O2S/c1-2-3-9-21-17-11-15(13-19)12-18(24(20,22)23)16(17)10-14-7-5-4-6-8-14/h4-8,11-12,21H,2-3,9-10,13H2,1H3,(H2,20,22,23) |
| InChIKey | TWOBYCZZOBOEDT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|