C18H23BrN2O3S — CID 57252602
5-(bromomethyl)-3-(pentylamino)-2-phenoxybenzenesulfonamide (PubChem CID 57252602) has the molecular formula C18H23BrN2O3S and a molecular weight of 427.36 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(pentylamino)-2-phenoxybenzenesulfonamide.
| Compound Name | 5-(bromomethyl)-3-(pentylamino)-2-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 57252602 |
| Molecular Formula | C18H23BrN2O3S |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 5-(bromomethyl)-3-(pentylamino)-2-phenoxybenzenesulfonamide |
| SMILES | CCCCCNc1cc(CBr)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C18H23BrN2O3S/c1-2-3-7-10-21-16-11-14(13-19)12-17(25(20,22)23)18(16)24-15-8-5-4-6-9-15/h4-6,8-9,11-12,21H,2-3,7,10,13H2,1H3,(H2,20,22,23) |
| InChIKey | FDJFKSDQRZVIJF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|