C22H26N4O3S — CID 139559227
3-(butylamino)-2-phenoxy-5-[(pyridin-2-ylamino)methyl]benzenesulfonamide (PubChem CID 139559227) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-(butylamino)-2-phenoxy-5-[(pyridin-2-ylamino)methyl]benzenesulfonamide.
| Compound Name | 3-(butylamino)-2-phenoxy-5-[(pyridin-2-ylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139559227 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3-(butylamino)-2-phenoxy-5-[(pyridin-2-ylamino)methyl]benzenesulfonamide |
| SMILES | CCCCNc1cc(CNc2ccccn2)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C22H26N4O3S/c1-2-3-12-24-19-14-17(16-26-21-11-7-8-13-25-21)15-20(30(23,27)28)22(19)29-18-9-5-4-6-10-18/h4-11,13-15,24H,2-3,12,16H2,1H3,(H,25,26)(H2,23,27,28) |
| InChIKey | NNRXHPQFEHPKML-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|